About (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid
(2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid (PubChem CID 174621334) has the molecular formula C16H13NO6
and a molecular weight of 315.28 g/mol. Its IUPAC name is (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid.
Molecular Properties
| Compound Name | (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid |
| PubChem CID | 174621334 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid |
| SMILES | CC(=O)C(=O)O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9NO3.C3H4O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2(4)3(5)6/h1-9H;1H3,(H,5,6) |
| InChIKey | QFFXEWMIKQCUMI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid?
The IUPAC name of (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid (CID 174621334) is (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid.
What is the SMILES notation for (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid?
The canonical SMILES for (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid is CC(=O)C(=O)O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid?
The InChIKey is QFFXEWMIKQCUMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C3H4O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2(4)3(5)6/h1-9H;1H3,(H,5,6).
What are the key properties of (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid?
(2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid has a molecular weight of 315.28 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)-phenylmethanone;2-oxopropanoic acid is sourced from PubChem (CID 174621334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).