About (2-nitrophenyl)-phenylmethanone;1H-pyrazole
(2-nitrophenyl)-phenylmethanone;1H-pyrazole (PubChem CID 161134312) has the molecular formula C16H13N3O3
and a molecular weight of 295.30 g/mol. Its IUPAC name is (2-nitrophenyl)-phenylmethanone;1H-pyrazole.
Molecular Properties
| Compound Name | (2-nitrophenyl)-phenylmethanone;1H-pyrazole |
| PubChem CID | 161134312 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2-nitrophenyl)-phenylmethanone;1H-pyrazole |
| SMILES | O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].c1cn[nH]c1 |
| InChI | InChI=1S/C13H9NO3.C3H4N2/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-4-5-3-1/h1-9H;1-3H,(H,4,5) |
| InChIKey | UMPCTZMFXSPUFZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)-phenylmethanone;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)-phenylmethanone;1H-pyrazole?
The IUPAC name of (2-nitrophenyl)-phenylmethanone;1H-pyrazole (CID 161134312) is (2-nitrophenyl)-phenylmethanone;1H-pyrazole.
What is the SMILES notation for (2-nitrophenyl)-phenylmethanone;1H-pyrazole?
The canonical SMILES for (2-nitrophenyl)-phenylmethanone;1H-pyrazole is O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].c1cn[nH]c1.
What is the InChIKey of (2-nitrophenyl)-phenylmethanone;1H-pyrazole?
The InChIKey is UMPCTZMFXSPUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C3H4N2/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-4-5-3-1/h1-9H;1-3H,(H,4,5).
What are the key properties of (2-nitrophenyl)-phenylmethanone;1H-pyrazole?
(2-nitrophenyl)-phenylmethanone;1H-pyrazole has a molecular weight of 295.30 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)-phenylmethanone;1H-pyrazole is sourced from PubChem (CID 161134312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).