C20H15N3O3 — CID 174938031
(2-nitrophenyl)-phenylmethanone;1H-pyrrolo[3,2-b]pyridine (PubChem CID 174938031) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is (2-nitrophenyl)-phenylmethanone;1H-pyrrolo[3,2-b]pyridine.
| Compound Name | (2-nitrophenyl)-phenylmethanone;1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 174938031 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2-nitrophenyl)-phenylmethanone;1H-pyrrolo[3,2-b]pyridine |
| SMILES | O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].c1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C13H9NO3.C7H6N2/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-6-7(8-4-1)3-5-9-6/h1-9H;1-5,9H |
| InChIKey | RNVFQJRDXIWDPT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|