About acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone
acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone (PubChem CID 70358542) has the molecular formula C15H13ClN2O4
and a molecular weight of 320.73 g/mol. Its IUPAC name is acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone.
Molecular Properties
| Compound Name | acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone |
| PubChem CID | 70358542 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone |
| SMILES | CC(N)=O.O=C(c1ccc(Cl)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8ClNO3.C2H5NO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15(17)18;1-2(3)4/h1-8H;1H3,(H2,3,4) |
| InChIKey | UQEYCZBVMGPCJT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone?
The IUPAC name of acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone (CID 70358542) is acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone.
What is the SMILES notation for acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone?
The canonical SMILES for acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone is CC(N)=O.O=C(c1ccc(Cl)cc1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone?
The InChIKey is UQEYCZBVMGPCJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO3.C2H5NO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15(17)18;1-2(3)4/h1-8H;1H3,(H2,3,4).
What are the key properties of acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone?
acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone has a molecular weight of 320.73 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;(4-chlorophenyl)-(2-nitrophenyl)methanone is sourced from PubChem (CID 70358542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).