C7H7N3O4 — CID 12620251
N-methyl-2,3-dinitroaniline (PubChem CID 12620251) has the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. Its IUPAC name is N-methyl-2,3-dinitroaniline.
| Compound Name | N-methyl-2,3-dinitroaniline |
|---|---|
| PubChem CID | 12620251 |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | N-methyl-2,3-dinitroaniline |
| SMILES | CNc1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O4/c1-8-5-3-2-4-6(9(11)12)7(5)10(13)14/h2-4,8H,1H3 |
| InChIKey | DFKNYKNMTFAISQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|