C11H4N6O4 — CID 168610866
2-(2,3-dinitroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168610866) has the molecular formula C11H4N6O4 and a molecular weight of 284.19 g/mol. Its IUPAC name is 2-(2,3-dinitroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2,3-dinitroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610866 |
| Molecular Formula | C11H4N6O4 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-(2,3-dinitroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H4N6O4/c12-4-7(5-13)9(6-14)15-8-2-1-3-10(16(18)19)11(8)17(20)21/h1-3,15H |
| InChIKey | YZPCLDXXVXTNSB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 169.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|