C18H9N5O3 — CID 168610452
2-(4-benzoyl-2-nitroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168610452) has the molecular formula C18H9N5O3 and a molecular weight of 343.30 g/mol. Its IUPAC name is 2-(4-benzoyl-2-nitroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-benzoyl-2-nitroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610452 |
| Molecular Formula | C18H9N5O3 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(4-benzoyl-2-nitroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(C(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H9N5O3/c19-9-14(10-20)16(11-21)22-15-7-6-13(8-17(15)23(25)26)18(24)12-4-2-1-3-5-12/h1-8,22H |
| InChIKey | MPOLHBZNQNRRCJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|