C17H10N6O2 — CID 168606278
2-(4-anilino-3-nitroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168606278) has the molecular formula C17H10N6O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-(4-anilino-3-nitroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-anilino-3-nitroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606278 |
| Molecular Formula | C17H10N6O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-(4-anilino-3-nitroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10N6O2/c18-9-12(10-19)16(11-20)22-14-6-7-15(17(8-14)23(24)25)21-13-4-2-1-3-5-13/h1-8,21-22H |
| InChIKey | RTOSZFKYWODXTR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|