C17H16N6O2 — CID 168608546
2-[4-(azepan-1-yl)-3-nitroanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608546) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-[4-(azepan-1-yl)-3-nitroanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(azepan-1-yl)-3-nitroanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608546 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[4-(azepan-1-yl)-3-nitroanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N6O2/c18-10-13(11-19)15(12-20)21-14-5-6-16(17(9-14)23(24)25)22-7-3-1-2-4-8-22/h5-6,9,21H,1-4,7-8H2 |
| InChIKey | KRQBWVAJMNWSHF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|