About 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate
3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate (PubChem CID 56992532) has the molecular formula C16H22ClN3O4
and a molecular weight of 355.82 g/mol. Its IUPAC name is 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate.
Molecular Properties
| Compound Name | 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate |
| PubChem CID | 56992532 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCCCCC2)c([N+](=O)[O-])c1)OCCCCl |
| InChI | InChI=1S/C16H22ClN3O4/c17-8-5-11-24-16(21)18-13-6-7-14(15(12-13)20(22)23)19-9-3-1-2-4-10-19/h6-7,12H,1-5,8-11H2,(H,18,21) |
| InChIKey | ZSZLVTMGQRRWEF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate?
The IUPAC name of 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate (CID 56992532) is 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate.
What is the SMILES notation for 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate?
The canonical SMILES for 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate is O=C(Nc1ccc(N2CCCCCC2)c([N+](=O)[O-])c1)OCCCCl.
What is the InChIKey of 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate?
The InChIKey is ZSZLVTMGQRRWEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClN3O4/c17-8-5-11-24-16(21)18-13-6-7-14(15(12-13)20(22)23)19-9-3-1-2-4-10-19/h6-7,12H,1-5,8-11H2,(H,18,21).
What are the key properties of 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate?
3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate has a molecular weight of 355.82 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl N-[4-(azepan-1-yl)-3-nitrophenyl]carbamate is sourced from PubChem (CID 56992532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).