C17H16FN5 — CID 168607976
2-[4-(azepan-1-yl)-3-fluoroanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607976) has the molecular formula C17H16FN5 and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[4-(azepan-1-yl)-3-fluoroanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(azepan-1-yl)-3-fluoroanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607976 |
| Molecular Formula | C17H16FN5 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[4-(azepan-1-yl)-3-fluoroanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(N2CCCCCC2)c(F)c1 |
| InChI | InChI=1S/C17H16FN5/c18-15-9-14(22-16(12-21)13(10-19)11-20)5-6-17(15)23-7-3-1-2-4-8-23/h5-6,9,22H,1-4,7-8H2 |
| InChIKey | OZRRQEDSCFKMLM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|