C17H17N5O — CID 168607889
2-(3-methoxy-4-piperidin-1-ylanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168607889) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-(3-methoxy-4-piperidin-1-ylanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3-methoxy-4-piperidin-1-ylanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607889 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-(3-methoxy-4-piperidin-1-ylanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | COc1cc(NC(C#N)=C(C#N)C#N)ccc1N1CCCCC1 |
| InChI | InChI=1S/C17H17N5O/c1-23-17-9-14(21-15(12-20)13(10-18)11-19)5-6-16(17)22-7-3-2-4-8-22/h5-6,9,21H,2-4,7-8H2,1H3 |
| InChIKey | VWWBKJKXPXNWOO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|