C15H12BrN5 — CID 168610309
2-(4-bromo-2-pyrrolidin-1-ylanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168610309) has the molecular formula C15H12BrN5 and a molecular weight of 342.20 g/mol. Its IUPAC name is 2-(4-bromo-2-pyrrolidin-1-ylanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-bromo-2-pyrrolidin-1-ylanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610309 |
| Molecular Formula | C15H12BrN5 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-(4-bromo-2-pyrrolidin-1-ylanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(Br)cc1N1CCCC1 |
| InChI | InChI=1S/C15H12BrN5/c16-12-3-4-13(15(7-12)21-5-1-2-6-21)20-14(10-19)11(8-17)9-18/h3-4,7,20H,1-2,5-6H2 |
| InChIKey | RCONFBILHGPXPJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|