C17H14BrFN6O — CID 168608844
2-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608844) has the molecular formula C17H14BrFN6O and a molecular weight of 417.24 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608844 |
| Molecular Formula | C17H14BrFN6O |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)-2-bromo-5-fluoroanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC(=O)N1CCN(c2cc(Br)c(NC(C#N)=C(C#N)C#N)cc2F)CC1 |
| InChI | InChI=1S/C17H14BrFN6O/c1-11(26)24-2-4-25(5-3-24)17-6-13(18)15(7-14(17)19)23-16(10-22)12(8-20)9-21/h6-7,23H,2-5H2,1H3 |
| InChIKey | UTACQFFZEZORFI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|