C13H7ClFN5O — CID 168607036
N-[5-chloro-4-fluoro-2-(1,2,2-tricyanoethenylamino)phenyl]acetamide (PubChem CID 168607036) has the molecular formula C13H7ClFN5O and a molecular weight of 303.68 g/mol. Its IUPAC name is N-[5-chloro-4-fluoro-2-(1,2,2-tricyanoethenylamino)phenyl]acetamide.
| Compound Name | N-[5-chloro-4-fluoro-2-(1,2,2-tricyanoethenylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 168607036 |
| Molecular Formula | C13H7ClFN5O |
| Molecular Weight | 303.68 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-[5-chloro-4-fluoro-2-(1,2,2-tricyanoethenylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(F)cc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C13H7ClFN5O/c1-7(21)19-11-2-9(14)10(15)3-12(11)20-13(6-18)8(4-16)5-17/h2-3,20H,1H3,(H,19,21) |
| InChIKey | REQVETDDZMWPIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|