C12H5FN4O2 — CID 168606194
4-fluoro-3-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168606194) has the molecular formula C12H5FN4O2 and a molecular weight of 256.20 g/mol. Its IUPAC name is 4-fluoro-3-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 4-fluoro-3-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168606194 |
| Molecular Formula | C12H5FN4O2 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-fluoro-3-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C12H5FN4O2/c13-9-2-1-7(12(18)19)3-10(9)17-11(6-16)8(4-14)5-15/h1-3,17H,(H,18,19) |
| InChIKey | VNTVUSYQGJNWMS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|