C13H8N4O3 — CID 168606277
3-methoxy-4-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168606277) has the molecular formula C13H8N4O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 3-methoxy-4-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 3-methoxy-4-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168606277 |
| Molecular Formula | C13H8N4O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-methoxy-4-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C13H8N4O3/c1-20-12-4-8(13(18)19)2-3-10(12)17-11(7-16)9(5-14)6-15/h2-4,17H,1H3,(H,18,19) |
| InChIKey | ZRHKERCKPTZAGT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|