C14H10N4O2 — CID 168607608
2-(4-acetyl-2-methoxyanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168607608) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-acetyl-2-methoxyanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607608 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-(4-acetyl-2-methoxyanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | COc1cc(C(C)=O)ccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C14H10N4O2/c1-9(19)10-3-4-12(14(5-10)20-2)18-13(8-17)11(6-15)7-16/h3-5,18H,1-2H3 |
| InChIKey | MFKFOYVWRYRUTD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|