C16H15N5O2 — CID 168607620
N-(2-methoxyethyl)-3-methyl-4-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168607620) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-methyl-4-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-(2-methoxyethyl)-3-methyl-4-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168607620 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(2-methoxyethyl)-3-methyl-4-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | COCCNC(=O)c1ccc(NC(C#N)=C(C#N)C#N)c(C)c1 |
| InChI | InChI=1S/C16H15N5O2/c1-11-7-12(16(22)20-5-6-23-2)3-4-14(11)21-15(10-19)13(8-17)9-18/h3-4,7,21H,5-6H2,1-2H3,(H,20,22) |
| InChIKey | CROZKQUQTFRFEM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|