C17H25N3O5S — CID 72923693
4-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]-N-(2-methoxyethyl)-3-methylbenzamide (PubChem CID 72923693) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]-N-(2-methoxyethyl)-3-methylbenzamide.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]-N-(2-methoxyethyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 72923693 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]-N-(2-methoxyethyl)-3-methylbenzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)NCC2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C17H25N3O5S/c1-12-9-14(16(21)18-6-7-25-2)3-4-15(12)20-17(22)19-10-13-5-8-26(23,24)11-13/h3-4,9,13H,5-8,10-11H2,1-2H3,(H,18,21)(H2,19,20,22) |
| InChIKey | JADBKAWWUQDMLU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|