C20H13N5O4 — CID 168609446
2-hydroxy-5-[[3-methyl-4-(1,2,2-tricyanoethenylamino)benzoyl]amino]benzoic acid (PubChem CID 168609446) has the molecular formula C20H13N5O4 and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-hydroxy-5-[[3-methyl-4-(1,2,2-tricyanoethenylamino)benzoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[3-methyl-4-(1,2,2-tricyanoethenylamino)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 168609446 |
| Molecular Formula | C20H13N5O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-hydroxy-5-[[3-methyl-4-(1,2,2-tricyanoethenylamino)benzoyl]amino]benzoic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(O)c(C(=O)O)c2)ccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C20H13N5O4/c1-11-6-12(2-4-16(11)25-17(10-23)13(8-21)9-22)19(27)24-14-3-5-18(26)15(7-14)20(28)29/h2-7,25-26H,1H3,(H,24,27)(H,28,29) |
| InChIKey | KQRBRCRBKFZHKP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 170.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|