C15H13N5O — CID 168607107
N-[3-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]propanamide (PubChem CID 168607107) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[3-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]propanamide.
| Compound Name | N-[3-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 168607107 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[3-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NC(C#N)=C(C#N)C#N)c(C)c1 |
| InChI | InChI=1S/C15H13N5O/c1-3-15(21)19-12-4-5-13(10(2)6-12)20-14(9-18)11(7-16)8-17/h4-6,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | WEUBZLPFHHPSFA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|