C15H12ClN5O — CID 168607949
N-[2-chloro-4-(1,2,2-tricyanoethenylamino)phenyl]butanamide (PubChem CID 168607949) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is N-[2-chloro-4-(1,2,2-tricyanoethenylamino)phenyl]butanamide.
| Compound Name | N-[2-chloro-4-(1,2,2-tricyanoethenylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 168607949 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[2-chloro-4-(1,2,2-tricyanoethenylamino)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(NC(C#N)=C(C#N)C#N)cc1Cl |
| InChI | InChI=1S/C15H12ClN5O/c1-2-3-15(22)21-13-5-4-11(6-12(13)16)20-14(9-19)10(7-17)8-18/h4-6,20H,2-3H2,1H3,(H,21,22) |
| InChIKey | PLPZCYIXNOMSNO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|