C17H17N5O2 — CID 168607043
N-[2-methoxy-5-(1,2,2-tricyanoethenylamino)phenyl]pentanamide (PubChem CID 168607043) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[2-methoxy-5-(1,2,2-tricyanoethenylamino)phenyl]pentanamide.
| Compound Name | N-[2-methoxy-5-(1,2,2-tricyanoethenylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 168607043 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-methoxy-5-(1,2,2-tricyanoethenylamino)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cc(NC(C#N)=C(C#N)C#N)ccc1OC |
| InChI | InChI=1S/C17H17N5O2/c1-3-4-5-17(23)22-14-8-13(6-7-16(14)24-2)21-15(11-20)12(9-18)10-19/h6-8,21H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | UDWGGULQCVOGKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|