C15H15ClN4O — CID 168543326
N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]pentanamide (PubChem CID 168543326) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]pentanamide.
| Compound Name | N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 168543326 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(NC=C(C#N)C#N)cc1Cl |
| InChI | InChI=1S/C15H15ClN4O/c1-2-3-4-15(21)20-14-6-5-12(7-13(14)16)19-10-11(8-17)9-18/h5-7,10,19H,2-4H2,1H3,(H,20,21) |
| InChIKey | JOCHIVYIKHPVAO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|