C15H9ClN4O2 — CID 71889275
N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxamide (PubChem CID 71889275) has the molecular formula C15H9ClN4O2 and a molecular weight of 312.72 g/mol. Its IUPAC name is N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71889275 |
| Molecular Formula | C15H9ClN4O2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-[2-chloro-4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxamide |
| SMILES | N#CC(C#N)=CNc1ccc(NC(=O)c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C15H9ClN4O2/c16-12-6-11(19-9-10(7-17)8-18)3-4-13(12)20-15(21)14-2-1-5-22-14/h1-6,9,19H,(H,20,21) |
| InChIKey | UUUNUISMQXBGMX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|