C15H16ClN7O — CID 169344602
N-[2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]pentanamide (PubChem CID 169344602) has the molecular formula C15H16ClN7O and a molecular weight of 345.79 g/mol. Its IUPAC name is N-[2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]pentanamide.
| Compound Name | N-[2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]pentanamide |
|---|---|
| PubChem CID | 169344602 |
| Molecular Formula | C15H16ClN7O |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(NC=C(C#N)c2nn[nH]n2)cc1Cl |
| InChI | InChI=1S/C15H16ClN7O/c1-2-3-4-14(24)19-13-6-5-11(7-12(13)16)18-9-10(8-17)15-20-22-23-21-15/h5-7,9,18H,2-4H2,1H3,(H,19,24)(H,20,21,22,23) |
| InChIKey | QFCDOYDDPIYREW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|