C16H18ClN7O — CID 169343165
3-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343165) has the molecular formula C16H18ClN7O and a molecular weight of 359.82 g/mol. Its IUPAC name is 3-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343165 |
| Molecular Formula | C16H18ClN7O |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC1CN(c2ccc(NC=C(C#N)c3nn[nH]n3)cc2Cl)CC(C)O1 |
| InChI | InChI=1S/C16H18ClN7O/c1-10-8-24(9-11(2)25-10)15-4-3-13(5-14(15)17)19-7-12(6-18)16-20-22-23-21-16/h3-5,7,10-11,19H,8-9H2,1-2H3,(H,20,21,22,23) |
| InChIKey | XJDVHPWVZMCHGD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|