C14H14ClN7 — CID 169344451
3-(5-chloro-2-pyrrolidin-1-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344451) has the molecular formula C14H14ClN7 and a molecular weight of 315.77 g/mol. Its IUPAC name is 3-(5-chloro-2-pyrrolidin-1-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(5-chloro-2-pyrrolidin-1-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344451 |
| Molecular Formula | C14H14ClN7 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-(5-chloro-2-pyrrolidin-1-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(Cl)ccc1N1CCCC1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H14ClN7/c15-11-3-4-13(22-5-1-2-6-22)12(7-11)17-9-10(8-16)14-18-20-21-19-14/h3-4,7,9,17H,1-2,5-6H2,(H,18,19,20,21) |
| InChIKey | XHYSHZOUQQYTRT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|