C11H9ClN6O — CID 169342755
3-(5-chloro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342755) has the molecular formula C11H9ClN6O and a molecular weight of 276.69 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(5-chloro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342755 |
| Molecular Formula | C11H9ClN6O |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 3-(5-chloro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | COc1ccc(Cl)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C11H9ClN6O/c1-19-10-3-2-8(12)4-9(10)14-6-7(5-13)11-15-17-18-16-11/h2-4,6,14H,1H3,(H,15,16,17,18) |
| InChIKey | FIFARCZVHYAHOP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|