C13H13FN6O2 — CID 169346792
3-[5-(dimethoxymethyl)-2-fluoroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346792) has the molecular formula C13H13FN6O2 and a molecular weight of 304.29 g/mol. Its IUPAC name is 3-[5-(dimethoxymethyl)-2-fluoroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[5-(dimethoxymethyl)-2-fluoroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346792 |
| Molecular Formula | C13H13FN6O2 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[5-(dimethoxymethyl)-2-fluoroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | COC(OC)c1ccc(F)c(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C13H13FN6O2/c1-21-13(22-2)8-3-4-10(14)11(5-8)16-7-9(6-15)12-17-19-20-18-12/h3-5,7,13,16H,1-2H3,(H,17,18,19,20) |
| InChIKey | ZTAJRNIOHIDTSR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|