C15H16FN7O2 — CID 169342769
tert-butyl N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorophenyl]carbamate (PubChem CID 169342769) has the molecular formula C15H16FN7O2 and a molecular weight of 345.34 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 169342769 |
| Molecular Formula | C15H16FN7O2 |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | tert-butyl N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)c(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C15H16FN7O2/c1-15(2,3)25-14(24)19-10-4-5-11(16)12(6-10)18-8-9(7-17)13-20-22-23-21-13/h4-6,8,18H,1-3H3,(H,19,24)(H,20,21,22,23) |
| InChIKey | QWWFORJAOZTZBK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|