C16H19N7O2 — CID 169344638
tert-butyl N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-methylphenyl]carbamate (PubChem CID 169344638) has the molecular formula C16H19N7O2 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 169344638 |
| Molecular Formula | C16H19N7O2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-methylphenyl]carbamate |
| SMILES | Cc1cc(NC=C(C#N)c2nn[nH]n2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19N7O2/c1-10-7-12(18-9-11(8-17)14-20-22-23-21-14)5-6-13(10)19-15(24)25-16(2,3)4/h5-7,9,18H,1-4H3,(H,19,24)(H,20,21,22,23) |
| InChIKey | OKVYWLLEYDJMDG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|