C19H23N7O2 — CID 169344861
tert-butyl 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 169344861) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is tert-butyl 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 169344861 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(NC=C(C#N)c3nn[nH]n3)cc2CC1 |
| InChI | InChI=1S/C19H23N7O2/c1-19(2,3)28-18(27)26-8-6-13-4-5-16(10-14(13)7-9-26)21-12-15(11-20)17-22-24-25-23-17/h4-5,10,12,21H,6-9H2,1-3H3,(H,22,23,24,25) |
| InChIKey | UKVJQNULRQRCDW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|