C20H26N8O2 — CID 169342694
tert-butyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 169342694) has the molecular formula C20H26N8O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is tert-butyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | tert-butyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 169342694 |
| Molecular Formula | C20H26N8O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | CN1CCN(c2ccc(C(=O)OC(C)(C)C)c(NC=C(C#N)c3nn[nH]n3)c2)CC1 |
| InChI | InChI=1S/C20H26N8O2/c1-20(2,3)30-19(29)16-6-5-15(28-9-7-27(4)8-10-28)11-17(16)22-13-14(12-21)18-23-25-26-24-18/h5-6,11,13,22H,7-10H2,1-4H3,(H,23,24,25,26) |
| InChIKey | RGJMJZHKPICYEX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|