C14H14ClN7O — CID 169346682
3-(2-chloro-5-morpholin-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346682) has the molecular formula C14H14ClN7O and a molecular weight of 331.77 g/mol. Its IUPAC name is 3-(2-chloro-5-morpholin-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-chloro-5-morpholin-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346682 |
| Molecular Formula | C14H14ClN7O |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-(2-chloro-5-morpholin-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(N2CCOCC2)ccc1Cl)c1nn[nH]n1 |
| InChI | InChI=1S/C14H14ClN7O/c15-12-2-1-11(22-3-5-23-6-4-22)7-13(12)17-9-10(8-16)14-18-20-21-19-14/h1-2,7,9,17H,3-6H2,(H,18,19,20,21) |
| InChIKey | SILPXBDMSRKCPP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|