C11H6ClN7O — CID 169345880
3-[(5-chloro-1,3-benzoxazol-6-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345880) has the molecular formula C11H6ClN7O and a molecular weight of 287.67 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzoxazol-6-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(5-chloro-1,3-benzoxazol-6-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345880 |
| Molecular Formula | C11H6ClN7O |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-[(5-chloro-1,3-benzoxazol-6-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc2ocnc2cc1Cl)c1nn[nH]n1 |
| InChI | InChI=1S/C11H6ClN7O/c12-7-1-9-10(20-5-15-9)2-8(7)14-4-6(3-13)11-16-18-19-17-11/h1-2,4-5,14H,(H,16,17,18,19) |
| InChIKey | UXWQNJUFAZDISC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|