C19H15ClN6O2 — CID 169345826
3-[2-chloro-5-(4-ethoxybenzoyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345826) has the molecular formula C19H15ClN6O2 and a molecular weight of 394.82 g/mol. Its IUPAC name is 3-[2-chloro-5-(4-ethoxybenzoyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-chloro-5-(4-ethoxybenzoyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345826 |
| Molecular Formula | C19H15ClN6O2 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-[2-chloro-5-(4-ethoxybenzoyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCOc1ccc(C(=O)c2ccc(Cl)c(NC=C(C#N)c3nn[nH]n3)c2)cc1 |
| InChI | InChI=1S/C19H15ClN6O2/c1-2-28-15-6-3-12(4-7-15)18(27)13-5-8-16(20)17(9-13)22-11-14(10-21)19-23-25-26-24-19/h3-9,11,22H,2H2,1H3,(H,23,24,25,26) |
| InChIKey | RYVGHSOXSLAVHQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|