C12H10FN7O — CID 169346501
4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-N-methylbenzamide (PubChem CID 169346501) has the molecular formula C12H10FN7O and a molecular weight of 287.26 g/mol. Its IUPAC name is 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-N-methylbenzamide.
| Compound Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 169346501 |
| Molecular Formula | C12H10FN7O |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC=C(C#N)c2nn[nH]n2)c(F)c1 |
| InChI | InChI=1S/C12H10FN7O/c1-15-12(21)7-2-3-10(9(13)4-7)16-6-8(5-14)11-17-19-20-18-11/h2-4,6,16H,1H3,(H,15,21)(H,17,18,19,20) |
| InChIKey | ULPKSHWJALPTKM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|