C12H11N7O — CID 169342393
N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide (PubChem CID 169342393) has the molecular formula C12H11N7O and a molecular weight of 269.27 g/mol. Its IUPAC name is N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide.
| Compound Name | N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 169342393 |
| Molecular Formula | C12H11N7O |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C12H11N7O/c1-8(20)15-11-5-3-2-4-10(11)14-7-9(6-13)12-16-18-19-17-12/h2-5,7,14H,1H3,(H,15,20)(H,16,17,18,19) |
| InChIKey | WOMJMRIXSXJCHO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|