C18H15N7O2 — CID 169343294
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(3-methoxyphenyl)benzamide (PubChem CID 169343294) has the molecular formula C18H15N7O2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 169343294 |
| Molecular Formula | C18H15N7O2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2ccccc2NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C18H15N7O2/c1-27-14-6-4-5-13(9-14)21-18(26)15-7-2-3-8-16(15)20-11-12(10-19)17-22-24-25-23-17/h2-9,11,20H,1H3,(H,21,26)(H,22,23,24,25) |
| InChIKey | BUDWPQNTKCHTRZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|