C15H17N7O — CID 169344790
N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2,4,6-trimethylphenyl]acetamide (PubChem CID 169344790) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2,4,6-trimethylphenyl]acetamide.
| Compound Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2,4,6-trimethylphenyl]acetamide |
|---|---|
| PubChem CID | 169344790 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2,4,6-trimethylphenyl]acetamide |
| SMILES | CC(=O)Nc1c(C)cc(C)c(NC=C(C#N)c2nn[nH]n2)c1C |
| InChI | InChI=1S/C15H17N7O/c1-8-5-9(2)14(18-11(4)23)10(3)13(8)17-7-12(6-16)15-19-21-22-20-15/h5,7,17H,1-4H3,(H,18,23)(H,19,20,21,22) |
| InChIKey | IRNSCFZGRLXHIE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|