C16H18N8O — CID 169343092
3-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343092) has the molecular formula C16H18N8O and a molecular weight of 338.38 g/mol. Its IUPAC name is 3-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343092 |
| Molecular Formula | C16H18N8O |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[(1,3-diethyl-6-methyl-2-oxobenzimidazol-5-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCn1c(=O)n(CC)c2cc(NC=C(C#N)c3nn[nH]n3)c(C)cc21 |
| InChI | InChI=1S/C16H18N8O/c1-4-23-13-6-10(3)12(7-14(13)24(5-2)16(23)25)18-9-11(8-17)15-19-21-22-20-15/h6-7,9,18H,4-5H2,1-3H3,(H,19,20,21,22) |
| InChIKey | AVVNMDVSHYAFJX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|