C11H10N6O3S — CID 169346738
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methylbenzenesulfonic acid (PubChem CID 169346738) has the molecular formula C11H10N6O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 169346738 |
| Molecular Formula | C11H10N6O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(NC=C(C#N)c2nn[nH]n2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H10N6O3S/c1-7-2-3-9(10(4-7)21(18,19)20)13-6-8(5-12)11-14-16-17-15-11/h2-4,6,13H,1H3,(H,18,19,20)(H,14,15,16,17) |
| InChIKey | QUGFIUJPMRTXBL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|