C19H19N7O4S2 — CID 169345506
3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-dimethyl-4-(4-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 169345506) has the molecular formula C19H19N7O4S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-dimethyl-4-(4-methylphenyl)sulfonylbenzenesulfonamide.
| Compound Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-dimethyl-4-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 169345506 |
| Molecular Formula | C19H19N7O4S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-dimethyl-4-(4-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)N(C)C)cc2NC=C(C#N)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C19H19N7O4S2/c1-13-4-6-15(7-5-13)31(27,28)18-9-8-16(32(29,30)26(2)3)10-17(18)21-12-14(11-20)19-22-24-25-23-19/h4-10,12,21H,1-3H3,(H,22,23,24,25) |
| InChIKey | AKUZHHQBNVUWRR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|