C16H19N7O — CID 169343117
N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methylphenyl]pentanamide (PubChem CID 169343117) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methylphenyl]pentanamide.
| Compound Name | N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methylphenyl]pentanamide |
|---|---|
| PubChem CID | 169343117 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(C)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C16H19N7O/c1-3-4-5-15(24)19-13-7-6-11(2)8-14(13)18-10-12(9-17)16-20-22-23-21-16/h6-8,10,18H,3-5H2,1-2H3,(H,19,24)(H,20,21,22,23) |
| InChIKey | NHDFFDLXQBFPAJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|