C11H10N6O4S — CID 169345530
3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxy-5-methylbenzenesulfonic acid (PubChem CID 169345530) has the molecular formula C11H10N6O4S and a molecular weight of 322.31 g/mol. Its IUPAC name is 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxy-5-methylbenzenesulfonic acid.
| Compound Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxy-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 169345530 |
| Molecular Formula | C11H10N6O4S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-hydroxy-5-methylbenzenesulfonic acid |
| SMILES | Cc1cc(NC=C(C#N)c2nn[nH]n2)c(O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H10N6O4S/c1-6-2-8(10(18)9(3-6)22(19,20)21)13-5-7(4-12)11-14-16-17-15-11/h2-3,5,13,18H,1H3,(H,19,20,21)(H,14,15,16,17) |
| InChIKey | UOZRBNBARRDAOH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 164.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|