C20H20N6O3S2 — CID 169345504
5-(4-tert-butylphenyl)sulfanyl-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzenesulfonic acid (PubChem CID 169345504) has the molecular formula C20H20N6O3S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)sulfanyl-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzenesulfonic acid.
| Compound Name | 5-(4-tert-butylphenyl)sulfanyl-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 169345504 |
| Molecular Formula | C20H20N6O3S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 5-(4-tert-butylphenyl)sulfanyl-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzenesulfonic acid |
| SMILES | CC(C)(C)c1ccc(Sc2ccc(NC=C(C#N)c3nn[nH]n3)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H20N6O3S2/c1-20(2,3)14-4-6-15(7-5-14)30-16-8-9-17(18(10-16)31(27,28)29)22-12-13(11-21)19-23-25-26-24-19/h4-10,12,22H,1-3H3,(H,27,28,29)(H,23,24,25,26) |
| InChIKey | VEYBZQPXNAIOIB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|