C21H18N4O3S2 — CID 168609367
5-(4-tert-butylphenyl)sulfanyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonic acid (PubChem CID 168609367) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)sulfanyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonic acid.
| Compound Name | 5-(4-tert-butylphenyl)sulfanyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 168609367 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 5-(4-tert-butylphenyl)sulfanyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonic acid |
| SMILES | CC(C)(C)c1ccc(Sc2ccc(NC(C#N)=C(C#N)C#N)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C21H18N4O3S2/c1-21(2,3)15-4-6-16(7-5-15)29-17-8-9-18(20(10-17)30(26,27)28)25-19(13-24)14(11-22)12-23/h4-10,25H,1-3H3,(H,26,27,28) |
| InChIKey | SPKCUXBQPNQQPA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|