C16H19NO3S2 — CID 124926997
4-amino-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid (PubChem CID 124926997) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-amino-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid.
| Compound Name | 4-amino-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid |
|---|---|
| PubChem CID | 124926997 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-amino-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid |
| SMILES | CC(C)(C)c1ccc(Sc2cc(S(=O)(=O)O)ccc2N)cc1 |
| InChI | InChI=1S/C16H19NO3S2/c1-16(2,3)11-4-6-12(7-5-11)21-15-10-13(22(18,19)20)8-9-14(15)17/h4-10H,17H2,1-3H3,(H,18,19,20) |
| InChIKey | NFUNSUCTMAHFPS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|